C21H18O14S — CID 91189859
(6,7-dihydroxy-4-oxo-2-phenylchromen-5-yl) (2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfooxyoxane-2-carboxylate (PubChem CID 91189859) has the molecular formula C21H18O14S and a molecular weight of 526.43 g/mol. Its IUPAC name is (6,7-dihydroxy-4-oxo-2-phenylchromen-5-yl) (2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfooxyoxane-2-carboxylate.
| Compound Name | (6,7-dihydroxy-4-oxo-2-phenylchromen-5-yl) (2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfooxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 91189859 |
| Molecular Formula | C21H18O14S |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | (6,7-dihydroxy-4-oxo-2-phenylchromen-5-yl) (2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfooxyoxane-2-carboxylate |
| SMILES | O=C(Oc1c(O)c(O)cc2oc(-c3ccccc3)cc(=O)c12)[C@H]1OC(OS(=O)(=O)O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O14S/c22-9-6-11(8-4-2-1-3-5-8)32-12-7-10(23)14(24)18(13(9)12)33-20(28)19-16(26)15(25)17(27)21(34-19)35-36(29,30)31/h1-7,15-17,19,21,23-27H,(H,29,30,31)/t15-,16-,17+,19-,21?/m0/s1 |
| InChIKey | RIORJBHXJVHFFW-IFHXMIEPSA-N |
| XLogP | -0.60 |
| TPSA | 230.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|