C14H13N3O3 — CID 91197894
ethyl 2-cyano-3-[(2-methyl-1,3-benzoxazol-5-yl)imino]propanoate (PubChem CID 91197894) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is ethyl 2-cyano-3-[(2-methyl-1,3-benzoxazol-5-yl)imino]propanoate.
| Compound Name | ethyl 2-cyano-3-[(2-methyl-1,3-benzoxazol-5-yl)imino]propanoate |
|---|---|
| PubChem CID | 91197894 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | ethyl 2-cyano-3-[(2-methyl-1,3-benzoxazol-5-yl)imino]propanoate |
| SMILES | CCOC(=O)C(C#N)/C=N/c1ccc2oc(C)nc2c1 |
| InChI | InChI=1S/C14H13N3O3/c1-3-19-14(18)10(7-15)8-16-11-4-5-13-12(6-11)17-9(2)20-13/h4-6,8,10H,3H2,1-2H3/b16-8+ |
| InChIKey | XKLQCCDAXDWXRY-LZYBPNLTSA-N |
| XLogP | 2.54 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|