About [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate
[4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate (PubChem CID 91204257) has the molecular formula C18H17NO3
and a molecular weight of 295.34 g/mol. Its IUPAC name is [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate.
Molecular Properties
| Compound Name | [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate |
| PubChem CID | 91204257 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate |
| SMILES | C=CC(=O)Nc1ccc(OC(=O)c2cccc(CC)c2)cc1 |
| InChI | InChI=1S/C18H17NO3/c1-3-13-6-5-7-14(12-13)18(21)22-16-10-8-15(9-11-16)19-17(20)4-2/h4-12H,2-3H2,1H3,(H,19,20) |
| InChIKey | UUVBDZNJUYEYGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate?
The IUPAC name of [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate (CID 91204257) is [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate.
What is the SMILES notation for [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate?
The canonical SMILES for [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate is C=CC(=O)Nc1ccc(OC(=O)c2cccc(CC)c2)cc1.
What is the InChIKey of [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate?
The InChIKey is UUVBDZNJUYEYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3/c1-3-13-6-5-7-14(12-13)18(21)22-16-10-8-15(9-11-16)19-17(20)4-2/h4-12H,2-3H2,1H3,(H,19,20).
What are the key properties of [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate?
[4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate has a molecular weight of 295.34 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(prop-2-enoylamino)phenyl] 3-ethylbenzoate is sourced from PubChem (CID 91204257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).