C30H37N9O12 — CID 91207521
cyanomethyl (2S)-2-[2-[(3,4-dimethoxyphenyl)methoxycarbonyl]-2-nitrohydrazinyl]-6-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]hexanoate (PubChem CID 91207521) has the molecular formula C30H37N9O12 and a molecular weight of 715.68 g/mol. Its IUPAC name is cyanomethyl (2S)-2-[2-[(3,4-dimethoxyphenyl)methoxycarbonyl]-2-nitrohydrazinyl]-6-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]hexanoate.
| Compound Name | cyanomethyl (2S)-2-[2-[(3,4-dimethoxyphenyl)methoxycarbonyl]-2-nitrohydrazinyl]-6-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 91207521 |
| Molecular Formula | C30H37N9O12 |
| Molecular Weight | 715.68 g/mol |
| Exact Mass | 715.26 |
| IUPAC Name | cyanomethyl (2S)-2-[2-[(3,4-dimethoxyphenyl)methoxycarbonyl]-2-nitrohydrazinyl]-6-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]hexanoate |
| SMILES | COc1ccc(COC(=O)N(N[C@@H](CCCCNC(=O)CCCCCNc2ccc([N+](=O)[O-])c3nonc23)C(=O)OCC#N)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C30H37N9O12/c1-47-24-13-10-20(18-25(24)48-2)19-50-30(42)37(39(45)46)34-22(29(41)49-17-14-31)8-5-7-16-33-26(40)9-4-3-6-15-32-21-11-12-23(38(43)44)28-27(21)35-51-36-28/h10-13,18,22,32,34H,3-9,15-17,19H2,1-2H3,(H,33,40)/t22-/m0/s1 |
| InChIKey | MOQWWJSSEQZPMK-QFIPXVFZSA-N |
| XLogP | 3.18 |
| TPSA | 276.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|