C20H28N8O7S — CID 58784441
(2S)-2-[[(2S)-2-[[2-(butanoylamino)acetyl]amino]-2-sulfanylacetyl]amino]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide (PubChem CID 58784441) has the molecular formula C20H28N8O7S and a molecular weight of 524.56 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-(butanoylamino)acetyl]amino]-2-sulfanylacetyl]amino]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[2-(butanoylamino)acetyl]amino]-2-sulfanylacetyl]amino]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
|---|---|
| PubChem CID | 58784441 |
| Molecular Formula | C20H28N8O7S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-(butanoylamino)acetyl]amino]-2-sulfanylacetyl]amino]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
| SMILES | CCCC(=O)NCC(=O)N[C@@H](S)C(=O)N[C@@H](CCCCNc1ccc([N+](=O)[O-])c2nonc12)C(N)=O |
| InChI | InChI=1S/C20H28N8O7S/c1-2-5-14(29)23-10-15(30)25-20(36)19(32)24-12(18(21)31)6-3-4-9-22-11-7-8-13(28(33)34)17-16(11)26-35-27-17/h7-8,12,20,22,36H,2-6,9-10H2,1H3,(H2,21,31)(H,23,29)(H,24,32)(H,25,30)/t12-,20-/m0/s1 |
| InChIKey | CANKFCRVNVFHMK-YUNKPMOVSA-N |
| XLogP | -0.03 |
| TPSA | 224.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|