C12H13I2N3O5S — CID 91208454
[[(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoyl]-(cyanomethyl)amino]methanesulfonic acid (PubChem CID 91208454) has the molecular formula C12H13I2N3O5S and a molecular weight of 565.13 g/mol. Its IUPAC name is [[(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoyl]-(cyanomethyl)amino]methanesulfonic acid.
| Compound Name | [[(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoyl]-(cyanomethyl)amino]methanesulfonic acid |
|---|---|
| PubChem CID | 91208454 |
| Molecular Formula | C12H13I2N3O5S |
| Molecular Weight | 565.13 g/mol |
| Exact Mass | 564.87 |
| IUPAC Name | [[(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoyl]-(cyanomethyl)amino]methanesulfonic acid |
| SMILES | N#CCN(CS(=O)(=O)O)C(=O)[C@@H](N)Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C12H13I2N3O5S/c13-8-3-7(4-9(14)11(8)18)5-10(16)12(19)17(2-1-15)6-23(20,21)22/h3-4,10,18H,2,5-6,16H2,(H,20,21,22)/t10-/m0/s1 |
| InChIKey | NBDSMWYIWYQZNZ-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 144.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.13 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|