C12H13I2N3O4S — CID 91443950
[4-[2-amino-3-(cyanomethylamino)-3-oxopropyl]-2,6-diiodophenyl] methanesulfonate (PubChem CID 91443950) has the molecular formula C12H13I2N3O4S and a molecular weight of 549.13 g/mol. Its IUPAC name is [4-[2-amino-3-(cyanomethylamino)-3-oxopropyl]-2,6-diiodophenyl] methanesulfonate.
| Compound Name | [4-[2-amino-3-(cyanomethylamino)-3-oxopropyl]-2,6-diiodophenyl] methanesulfonate |
|---|---|
| PubChem CID | 91443950 |
| Molecular Formula | C12H13I2N3O4S |
| Molecular Weight | 549.13 g/mol |
| Exact Mass | 548.87 |
| IUPAC Name | [4-[2-amino-3-(cyanomethylamino)-3-oxopropyl]-2,6-diiodophenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1c(I)cc(CC(N)C(=O)NCC#N)cc1I |
| InChI | InChI=1S/C12H13I2N3O4S/c1-22(19,20)21-11-8(13)4-7(5-9(11)14)6-10(16)12(18)17-3-2-15/h4-5,10H,3,6,16H2,1H3,(H,17,18) |
| InChIKey | CJNHEXJQMWCUIZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.13 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|