C9H17N3O4S — CID 22893113
(2S)-2-amino-N-(cyanomethyl)-4-methylpent-4-enamide;methanesulfonic acid (PubChem CID 22893113) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyanomethyl)-4-methylpent-4-enamide;methanesulfonic acid.
| Compound Name | (2S)-2-amino-N-(cyanomethyl)-4-methylpent-4-enamide;methanesulfonic acid |
|---|---|
| PubChem CID | 22893113 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2S)-2-amino-N-(cyanomethyl)-4-methylpent-4-enamide;methanesulfonic acid |
| SMILES | C=C(C)C[C@H](N)C(=O)NCC#N.CS(=O)(=O)O |
| InChI | InChI=1S/C8H13N3O.CH4O3S/c1-6(2)5-7(10)8(12)11-4-3-9;1-5(2,3)4/h7H,1,4-5,10H2,2H3,(H,11,12);1H3,(H,2,3,4)/t7-;/m0./s1 |
| InChIKey | SYIWZWWGKLHVPT-FJXQXJEOSA-N |
| XLogP | -0.58 |
| TPSA | 133.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|