C26H39NO2 — CID 91213749
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(4S)-4-hydroxy-4-phenylpent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91213749) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(4S)-4-hydroxy-4-phenylpent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(4S)-4-hydroxy-4-phenylpent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91213749 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(4S)-4-hydroxy-4-phenylpent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CN(C)CCCCCC1=C[C@H]2C[C@@H](O)[C@H](C=CC[C@](C)(O)c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C26H39NO2/c1-26(29,22-12-7-4-8-13-22)15-10-14-23-24-18-20(17-21(24)19-25(23)28)11-6-5-9-16-27(2)3/h4,7-8,10,12-14,17,21,23-25,28-29H,5-6,9,11,15-16,18-19H2,1-3H3/t21-,23+,24-,25+,26-/m0/s1 |
| InChIKey | PXVVEAPESQDULC-FYHLHOPESA-N |
| XLogP | 4.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|