C30H33N3O7 — CID 91214408
(4S,4aS,5aR,12aS)-9-amino-7-[4-(dimethylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91214408) has the molecular formula C30H33N3O7 and a molecular weight of 547.61 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-amino-7-[4-(dimethylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-amino-7-[4-(dimethylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91214408 |
| Molecular Formula | C30H33N3O7 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-amino-7-[4-(dimethylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(N)cc(-c5ccc(N(C)C)cc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H33N3O7/c1-12(2)20-18-10-14-9-17-16(13-5-7-15(8-6-13)33(3)4)11-19(31)24(34)22(17)26(36)21(14)27(37)30(18,40)28(38)23(25(20)35)29(32)39/h5-8,11-12,14,18,20-21,23,34,40H,9-10,31H2,1-4H3,(H2,32,39)/t14-,18-,20-,21?,23?,30-/m0/s1 |
| InChIKey | RVAPYYAIAZWDOL-WHVNOUDZSA-N |
| XLogP | 1.52 |
| TPSA | 181.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|