C33H21F6N3 — CID 91214801
2-(3'-propyl-9,9'-spirobi[fluorene]-2'-yl)-4,6-bis(trifluoromethyl)-1,3,5-triazine (PubChem CID 91214801) has the molecular formula C33H21F6N3 and a molecular weight of 573.54 g/mol. Its IUPAC name is 2-(3'-propyl-9,9'-spirobi[fluorene]-2'-yl)-4,6-bis(trifluoromethyl)-1,3,5-triazine.
| Compound Name | 2-(3'-propyl-9,9'-spirobi[fluorene]-2'-yl)-4,6-bis(trifluoromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 91214801 |
| Molecular Formula | C33H21F6N3 |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 2-(3'-propyl-9,9'-spirobi[fluorene]-2'-yl)-4,6-bis(trifluoromethyl)-1,3,5-triazine |
| SMILES | CCCc1cc2c(cc1-c1nc(C(F)(F)F)nc(C(F)(F)F)n1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C33H21F6N3/c1-2-9-18-16-23-21-12-5-8-15-26(21)31(24-13-6-3-10-19(24)20-11-4-7-14-25(20)31)27(23)17-22(18)28-40-29(32(34,35)36)42-30(41-28)33(37,38)39/h3-8,10-17H,2,9H2,1H3 |
| InChIKey | NTRHNEJCNRSZPF-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |