C25H31N3O2 — CID 91224323
6-[3-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]piperidin-1-yl]-3H-2-benzofuran-1-one (PubChem CID 91224323) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 6-[3-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]piperidin-1-yl]-3H-2-benzofuran-1-one.
| Compound Name | 6-[3-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]piperidin-1-yl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 91224323 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 6-[3-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]piperidin-1-yl]-3H-2-benzofuran-1-one |
| SMILES | CN1CCN(c2ccccc2CC2CCCN(c3ccc4c(c3)C(=O)OC4)C2)CC1 |
| InChI | InChI=1S/C25H31N3O2/c1-26-11-13-27(14-12-26)24-7-3-2-6-20(24)15-19-5-4-10-28(17-19)22-9-8-21-18-30-25(29)23(21)16-22/h2-3,6-9,16,19H,4-5,10-15,17-18H2,1H3 |
| InChIKey | INHLZBWVCIQFMI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |