C21H26ClN5O3 — CID 91224513
4-[[2-amino-2-(aminohydrazinylidene)acetyl]amino]-6-[4-(3-chlorophenyl)phenyl]-2-methylhexanoic acid (PubChem CID 91224513) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 4-[[2-amino-2-(aminohydrazinylidene)acetyl]amino]-6-[4-(3-chlorophenyl)phenyl]-2-methylhexanoic acid.
| Compound Name | 4-[[2-amino-2-(aminohydrazinylidene)acetyl]amino]-6-[4-(3-chlorophenyl)phenyl]-2-methylhexanoic acid |
|---|---|
| PubChem CID | 91224513 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-[[2-amino-2-(aminohydrazinylidene)acetyl]amino]-6-[4-(3-chlorophenyl)phenyl]-2-methylhexanoic acid |
| SMILES | CC(CC(CCc1ccc(-c2cccc(Cl)c2)cc1)NC(=O)C(N)=NNN)C(=O)O |
| InChI | InChI=1S/C21H26ClN5O3/c1-13(21(29)30)11-18(25-20(28)19(23)26-27-24)10-7-14-5-8-15(9-6-14)16-3-2-4-17(22)12-16/h2-6,8-9,12-13,18,27H,7,10-11,24H2,1H3,(H2,23,26)(H,25,28)(H,29,30) |
| InChIKey | TVCXBUYJUAFYEV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|