C21H25FN2O — CID 91232310
[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2-prop-2-enyl-2,3,6,7-tetrahydro-1H-inden-1-yl]methanol (PubChem CID 91232310) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is [5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2-prop-2-enyl-2,3,6,7-tetrahydro-1H-inden-1-yl]methanol.
| Compound Name | [5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2-prop-2-enyl-2,3,6,7-tetrahydro-1H-inden-1-yl]methanol |
|---|---|
| PubChem CID | 91232310 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2-prop-2-enyl-2,3,6,7-tetrahydro-1H-inden-1-yl]methanol |
| SMILES | [H]/N=C/C1CC2(C)C(=C/C1=N\c1ccc(F)cc1)CC(CC=C)C2CO |
| InChI | InChI=1S/C21H25FN2O/c1-3-4-14-9-16-10-20(24-18-7-5-17(22)6-8-18)15(12-23)11-21(16,2)19(14)13-25/h3,5-8,10,12,14-15,19,23,25H,1,4,9,11,13H2,2H3/b23-12+,24-20+ |
| InChIKey | BISJDUOELUCJGM-UANSKCEJSA-N |
| XLogP | 4.70 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|