About 4-(4H-chromen-2-yl)-1,2-thiazole
4-(4H-chromen-2-yl)-1,2-thiazole (PubChem CID 91234249) has the molecular formula C12H9NOS
and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-(4H-chromen-2-yl)-1,2-thiazole.
Molecular Properties
| Compound Name | 4-(4H-chromen-2-yl)-1,2-thiazole |
| PubChem CID | 91234249 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 4-(4H-chromen-2-yl)-1,2-thiazole |
| SMILES | C1=C(c2cnsc2)Oc2ccccc2C1 |
| InChI | InChI=1S/C12H9NOS/c1-2-4-11-9(3-1)5-6-12(14-11)10-7-13-15-8-10/h1-4,6-8H,5H2 |
| InChIKey | DBDIHFPURJFEON-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4H-chromen-2-yl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4H-chromen-2-yl)-1,2-thiazole?
The IUPAC name of 4-(4H-chromen-2-yl)-1,2-thiazole (CID 91234249) is 4-(4H-chromen-2-yl)-1,2-thiazole.
What is the SMILES notation for 4-(4H-chromen-2-yl)-1,2-thiazole?
The canonical SMILES for 4-(4H-chromen-2-yl)-1,2-thiazole is C1=C(c2cnsc2)Oc2ccccc2C1.
What is the InChIKey of 4-(4H-chromen-2-yl)-1,2-thiazole?
The InChIKey is DBDIHFPURJFEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NOS/c1-2-4-11-9(3-1)5-6-12(14-11)10-7-13-15-8-10/h1-4,6-8H,5H2.
What are the key properties of 4-(4H-chromen-2-yl)-1,2-thiazole?
4-(4H-chromen-2-yl)-1,2-thiazole has a molecular weight of 215.28 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4H-chromen-2-yl)-1,2-thiazole is sourced from PubChem (CID 91234249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).