C9H16O4S2 — CID 91235555
4-(3-methylbutoxy)-4-oxo-2,2-bis(sulfanyl)butanoic acid (PubChem CID 91235555) has the molecular formula C9H16O4S2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-4-oxo-2,2-bis(sulfanyl)butanoic acid.
| Compound Name | 4-(3-methylbutoxy)-4-oxo-2,2-bis(sulfanyl)butanoic acid |
|---|---|
| PubChem CID | 91235555 |
| Molecular Formula | C9H16O4S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(3-methylbutoxy)-4-oxo-2,2-bis(sulfanyl)butanoic acid |
| SMILES | CC(C)CCOC(=O)CC(S)(S)C(=O)O |
| InChI | InChI=1S/C9H16O4S2/c1-6(2)3-4-13-7(10)5-9(14,15)8(11)12/h6,14-15H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | IOVCHVZMNWLUAK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|