C29H31N3O5 — CID 91242803
tert-butyl (4S)-2,4-diamino-5-(1H-indol-3-yl)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]-3-oxopentanoate (PubChem CID 91242803) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is tert-butyl (4S)-2,4-diamino-5-(1H-indol-3-yl)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]-3-oxopentanoate.
| Compound Name | tert-butyl (4S)-2,4-diamino-5-(1H-indol-3-yl)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]-3-oxopentanoate |
|---|---|
| PubChem CID | 91242803 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | tert-butyl (4S)-2,4-diamino-5-(1H-indol-3-yl)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]-3-oxopentanoate |
| SMILES | CC1=C(CC(N)(C(=O)OC(C)(C)C)C(=O)[C@@H](N)Cc2c[nH]c3ccccc23)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H31N3O5/c1-16-21(25(34)20-11-6-5-10-19(20)24(16)33)14-29(31,27(36)37-28(2,3)4)26(35)22(30)13-17-15-32-23-12-8-7-9-18(17)23/h5-12,15,22,32H,13-14,30-31H2,1-4H3/t22-,29?/m0/s1 |
| InChIKey | XNGROHCGWANYDE-RBQQCVMASA-N |
| XLogP | 3.43 |
| TPSA | 145.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|