C16H11ClF3NO2 — CID 91249884
7-chloro-2-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroisoindol-1-ol (PubChem CID 91249884) has the molecular formula C16H11ClF3NO2 and a molecular weight of 341.72 g/mol. Its IUPAC name is 7-chloro-2-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroisoindol-1-ol.
| Compound Name | 7-chloro-2-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroisoindol-1-ol |
|---|---|
| PubChem CID | 91249884 |
| Molecular Formula | C16H11ClF3NO2 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 7-chloro-2-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroisoindol-1-ol |
| SMILES | Oc1c2c(Cl)cc(F)cc2cn1Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H11ClF3NO2/c17-13-6-11(18)5-10-8-21(15(22)14(10)13)7-9-1-3-12(4-2-9)23-16(19)20/h1-6,8,16,22H,7H2 |
| InChIKey | YQTRLWJPWXFDII-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |