C15H9F3N2O5S — CID 91250903
7-oxo-2-[4-(trifluoromethyl)phenyl]-4,6-dihydro-[1,3]thiazolo[4,5-c]pyridine-5,6-dicarboxylic acid (PubChem CID 91250903) has the molecular formula C15H9F3N2O5S and a molecular weight of 386.31 g/mol. Its IUPAC name is 7-oxo-2-[4-(trifluoromethyl)phenyl]-4,6-dihydro-[1,3]thiazolo[4,5-c]pyridine-5,6-dicarboxylic acid.
| Compound Name | 7-oxo-2-[4-(trifluoromethyl)phenyl]-4,6-dihydro-[1,3]thiazolo[4,5-c]pyridine-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91250903 |
| Molecular Formula | C15H9F3N2O5S |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 7-oxo-2-[4-(trifluoromethyl)phenyl]-4,6-dihydro-[1,3]thiazolo[4,5-c]pyridine-5,6-dicarboxylic acid |
| SMILES | O=C(O)C1C(=O)c2sc(-c3ccc(C(F)(F)F)cc3)nc2CN1C(=O)O |
| InChI | InChI=1S/C15H9F3N2O5S/c16-15(17,18)7-3-1-6(2-4-7)12-19-8-5-20(14(24)25)9(13(22)23)10(21)11(8)26-12/h1-4,9H,5H2,(H,22,23)(H,24,25) |
| InChIKey | FRKVORCELYTAFD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|