C13H24O5 — CID 91252711
4-methyl-5-[2-(2-propoxyethoxy)ethoxy]pent-2-enoic acid (PubChem CID 91252711) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-methyl-5-[2-(2-propoxyethoxy)ethoxy]pent-2-enoic acid.
| Compound Name | 4-methyl-5-[2-(2-propoxyethoxy)ethoxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 91252711 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-methyl-5-[2-(2-propoxyethoxy)ethoxy]pent-2-enoic acid |
| SMILES | CCCOCCOCCOCC(C)C=CC(=O)O |
| InChI | InChI=1S/C13H24O5/c1-3-6-16-7-8-17-9-10-18-11-12(2)4-5-13(14)15/h4-5,12H,3,6-11H2,1-2H3,(H,14,15) |
| InChIKey | BWQOEFGUXIGHON-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|