C20H25N3O2 — CID 91253473
tert-butyl 2-ethyl-5-(6-ethynyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 91253473) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl 2-ethyl-5-(6-ethynyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-ethyl-5-(6-ethynyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91253473 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | tert-butyl 2-ethyl-5-(6-ethynyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C#Cc1ccc2nc(C3CCC(CC)N3C(=O)OC(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C20H25N3O2/c1-6-13-8-10-15-16(12-13)22-18(21-15)17-11-9-14(7-2)23(17)19(24)25-20(3,4)5/h1,8,10,12,14,17H,7,9,11H2,2-5H3,(H,21,22) |
| InChIKey | HUPPNHLIUSHIQM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|