C15H21ClFN3O3 — CID 91254105
ethyl 2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate (PubChem CID 91254105) has the molecular formula C15H21ClFN3O3 and a molecular weight of 345.80 g/mol. Its IUPAC name is ethyl 2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate.
| Compound Name | ethyl 2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate |
|---|---|
| PubChem CID | 91254105 |
| Molecular Formula | C15H21ClFN3O3 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | ethyl 2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate |
| SMILES | CCOC(=O)C(C)C1(O)CCCC(Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C15H21ClFN3O3/c1-3-23-13(21)9(2)15(22)6-4-5-10(7-15)19-12-11(17)8-18-14(16)20-12/h8-10,22H,3-7H2,1-2H3,(H,18,19,20) |
| InChIKey | IKUNNUXFCXYVKK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |