C24H33N3O5SSi — CID 91254431
(3S,4S,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylperoxy-6-methylsulfanyloxan-3-ol (PubChem CID 91254431) has the molecular formula C24H33N3O5SSi and a molecular weight of 503.70 g/mol. Its IUPAC name is (3S,4S,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylperoxy-6-methylsulfanyloxan-3-ol.
| Compound Name | (3S,4S,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylperoxy-6-methylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 91254431 |
| Molecular Formula | C24H33N3O5SSi |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (3S,4S,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylperoxy-6-methylsulfanyloxan-3-ol |
| SMILES | COOC1[C@@H](N=[N+]=[N-])[C@H](O)C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1SC |
| InChI | InChI=1S/C24H33N3O5SSi/c1-24(2,3)34(17-12-8-6-9-13-17,18-14-10-7-11-15-18)30-16-19-21(28)20(26-27-25)22(32-29-4)23(31-19)33-5/h6-15,19-23,28H,16H2,1-5H3/t19?,20-,21+,22?,23-/m0/s1 |
| InChIKey | WXEBFHSZTZGKCU-XRKUWORCSA-N |
| XLogP | 3.64 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|