C28H37N3O6SSi — CID 58679017
[(2S,4S,5R)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-2-methylsulfanyloxan-3-yl] 4-oxopentanoate (PubChem CID 58679017) has the molecular formula C28H37N3O6SSi and a molecular weight of 571.77 g/mol. Its IUPAC name is [(2S,4S,5R)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-2-methylsulfanyloxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2S,4S,5R)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-2-methylsulfanyloxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 58679017 |
| Molecular Formula | C28H37N3O6SSi |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | [(2S,4S,5R)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-2-methylsulfanyloxan-3-yl] 4-oxopentanoate |
| SMILES | CS[C@@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@H](N=[N+]=[N-])C1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C28H37N3O6SSi/c1-19(32)16-17-23(33)37-26-24(30-31-29)25(34)22(36-27(26)38-5)18-35-39(28(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,22,24-27,34H,16-18H2,1-5H3/t22?,24-,25-,26?,27-/m0/s1 |
| InChIKey | PLLQINNMOHNISD-DRDSAKHUSA-N |
| XLogP | 3.97 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|