C30H39N3O7Si — CID 101273596
[(2R,3S,4R,5R,6R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-prop-2-enoxyoxan-4-yl] 4-oxopentanoate (PubChem CID 101273596) has the molecular formula C30H39N3O7Si and a molecular weight of 581.74 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-prop-2-enoxyoxan-4-yl] 4-oxopentanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-prop-2-enoxyoxan-4-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 101273596 |
| Molecular Formula | C30H39N3O7Si |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-prop-2-enoxyoxan-4-yl] 4-oxopentanoate |
| SMILES | C=CCO[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](OC(=O)CCC(C)=O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C30H39N3O7Si/c1-6-19-37-29-26(32-33-31)28(40-25(35)18-17-21(2)34)27(36)24(39-29)20-38-41(30(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h6-16,24,26-29,36H,1,17-20H2,2-5H3/t24-,26-,27-,28-,29-/m1/s1 |
| InChIKey | FALUAJBFBKJSAZ-SRUILXRCSA-N |
| XLogP | 3.81 |
| TPSA | 140.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|