C39H59N3O7SSi — CID 45140114
[(2R,3S,4R,5R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-octylsulfanyloxan-3-yl] 2-methylpropanoate (PubChem CID 45140114) has the molecular formula C39H59N3O7SSi and a molecular weight of 742.07 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-octylsulfanyloxan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-octylsulfanyloxan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 45140114 |
| Molecular Formula | C39H59N3O7SSi |
| Molecular Weight | 742.07 g/mol |
| Exact Mass | 741.38 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-octylsulfanyloxan-3-yl] 2-methylpropanoate |
| SMILES | CCCCCCCCS[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(=O)C(C)C)[C@@H](N=[N+]=[N-])[C@H]1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H59N3O7SSi/c1-10-11-12-13-14-21-26-50-36-34(48-37(44)49-38(4,5)6)32(41-42-40)33(47-35(43)28(2)3)31(46-36)27-45-51(39(7,8)9,29-22-17-15-18-23-29)30-24-19-16-20-25-30/h15-20,22-25,28,31-34,36H,10-14,21,26-27H2,1-9H3/t31-,32-,33-,34-,36+/m1/s1 |
| InChIKey | VCNZVFJPHRZUFW-CLNUGPORSA-N |
| XLogP | 8.95 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.07 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|