C30H35N3O5SSi — CID 71763862
[(2S,3S,4S,5R,6S)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyloxan-4-yl] acetate (PubChem CID 71763862) has the molecular formula C30H35N3O5SSi and a molecular weight of 577.78 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyloxan-4-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 71763862 |
| Molecular Formula | C30H35N3O5SSi |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C30H35N3O5SSi/c1-21(34)37-28-26(32-33-31)25(38-29(27(28)35)39-22-14-8-5-9-15-22)20-36-40(30(2,3)4,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,25-29,35H,20H2,1-4H3/t25-,26+,27-,28+,29+/m1/s1 |
| InChIKey | UYAJXZSDKDZXKW-ZCCUTQAASA-N |
| XLogP | 5.05 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|