C23H32 — CID 91257944
ethane;2-(4-ethenylphenyl)-6-ethyl-4,5-dihydro-1H-indene (PubChem CID 91257944) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is ethane;2-(4-ethenylphenyl)-6-ethyl-4,5-dihydro-1H-indene.
| Compound Name | ethane;2-(4-ethenylphenyl)-6-ethyl-4,5-dihydro-1H-indene |
|---|---|
| PubChem CID | 91257944 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | ethane;2-(4-ethenylphenyl)-6-ethyl-4,5-dihydro-1H-indene |
| SMILES | C=Cc1ccc(C2=CC3=C(C=C(CC)CC3)C2)cc1.CC.CC |
| InChI | InChI=1S/C19H20.2C2H6/c1-3-14-5-8-16(9-6-14)19-12-17-10-7-15(4-2)11-18(17)13-19;2*1-2/h3,5-6,8-9,11-12H,1,4,7,10,13H2,2H3;2*1-2H3 |
| InChIKey | AIVKMKGDWSLWLW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |