C18H10I4O7 — CID 91258776
3-[4-[3-(4-hydroxy-3,5-diiodophenyl)-2-oxopropanoyl]oxy-3,5-diiodophenyl]-2-oxopropanoic acid (PubChem CID 91258776) has the molecular formula C18H10I4O7 and a molecular weight of 845.89 g/mol. Its IUPAC name is 3-[4-[3-(4-hydroxy-3,5-diiodophenyl)-2-oxopropanoyl]oxy-3,5-diiodophenyl]-2-oxopropanoic acid.
| Compound Name | 3-[4-[3-(4-hydroxy-3,5-diiodophenyl)-2-oxopropanoyl]oxy-3,5-diiodophenyl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 91258776 |
| Molecular Formula | C18H10I4O7 |
| Molecular Weight | 845.89 g/mol |
| Exact Mass | 845.66 |
| IUPAC Name | 3-[4-[3-(4-hydroxy-3,5-diiodophenyl)-2-oxopropanoyl]oxy-3,5-diiodophenyl]-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)Cc1cc(I)c(OC(=O)C(=O)Cc2cc(I)c(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C18H10I4O7/c19-9-1-7(2-10(20)15(9)25)6-14(24)18(28)29-16-11(21)3-8(4-12(16)22)5-13(23)17(26)27/h1-4,25H,5-6H2,(H,26,27) |
| InChIKey | IJBCHJUGFRHKSW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|