C19H14I2O6 — CID 176720410
4-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]benzoic acid (PubChem CID 176720410) has the molecular formula C19H14I2O6 and a molecular weight of 592.12 g/mol. Its IUPAC name is 4-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]benzoic acid.
| Compound Name | 4-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 176720410 |
| Molecular Formula | C19H14I2O6 |
| Molecular Weight | 592.12 g/mol |
| Exact Mass | 591.89 |
| IUPAC Name | 4-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]benzoic acid |
| SMILES | C=C(C)C(=O)Oc1c(I)cc(COC(=O)c2ccc(C(=O)O)cc2)cc1I |
| InChI | InChI=1S/C19H14I2O6/c1-10(2)18(24)27-16-14(20)7-11(8-15(16)21)9-26-19(25)13-5-3-12(4-6-13)17(22)23/h3-8H,1,9H2,2H3,(H,22,23) |
| InChIKey | XHXGZFAXMKVTGT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.12 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|