C11H19N — CID 91259001
N,3-dimethyl-6-methylideneoct-3-en-2-imine (PubChem CID 91259001) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N,3-dimethyl-6-methylideneoct-3-en-2-imine.
| Compound Name | N,3-dimethyl-6-methylideneoct-3-en-2-imine |
|---|---|
| PubChem CID | 91259001 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N,3-dimethyl-6-methylideneoct-3-en-2-imine |
| SMILES | C=C(CC)CC=C(C)/C(C)=N/C |
| InChI | InChI=1S/C11H19N/c1-6-9(2)7-8-10(3)11(4)12-5/h8H,2,6-7H2,1,3-5H3/b10-8?,12-11+ |
| InChIKey | XNKLLNHVFLODCC-OPLIEGRNSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|