C20H42N2 — CID 91264150
N'-(2,4,8,8,10,10-hexamethylundec-5-en-2-yl)propane-1,3-diamine (PubChem CID 91264150) has the molecular formula C20H42N2 and a molecular weight of 310.57 g/mol. Its IUPAC name is N'-(2,4,8,8,10,10-hexamethylundec-5-en-2-yl)propane-1,3-diamine.
| Compound Name | N'-(2,4,8,8,10,10-hexamethylundec-5-en-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 91264150 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | N'-(2,4,8,8,10,10-hexamethylundec-5-en-2-yl)propane-1,3-diamine |
| SMILES | CC(C=CCC(C)(C)CC(C)(C)C)CC(C)(C)NCCCN |
| InChI | InChI=1S/C20H42N2/c1-17(15-20(7,8)22-14-10-13-21)11-9-12-19(5,6)16-18(2,3)4/h9,11,17,22H,10,12-16,21H2,1-8H3 |
| InChIKey | SWLRPGFTCATPQK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|