About 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine
5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine (PubChem CID 88934309) has the molecular formula C18H35N
and a molecular weight of 265.48 g/mol. Its IUPAC name is 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine.
Molecular Properties
| Compound Name | 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine |
| PubChem CID | 88934309 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine |
| SMILES | C=CCCCC(=CC(CC)CC(C)(C)C)CCNC |
| InChI | InChI=1S/C18H35N/c1-7-9-10-11-17(12-13-19-6)14-16(8-2)15-18(3,4)5/h7,14,16,19H,1,8-13,15H2,2-6H3 |
| InChIKey | QUJLWIYPMLEEKL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine?
The IUPAC name of 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine (CID 88934309) is 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine.
What is the SMILES notation for 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine?
The canonical SMILES for 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine is C=CCCCC(=CC(CC)CC(C)(C)C)CCNC.
What is the InChIKey of 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine?
The InChIKey is QUJLWIYPMLEEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N/c1-7-9-10-11-17(12-13-19-6)14-16(8-2)15-18(3,4)5/h7,14,16,19H,1,8-13,15H2,2-6H3.
What are the key properties of 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine?
5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine has a molecular weight of 265.48 g/mol, XLogP of 5.34, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine is sourced from PubChem (CID 88934309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).