C18H35N — CID 88934309
5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine (PubChem CID 88934309) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine.
| Compound Name | 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine |
|---|---|
| PubChem CID | 88934309 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 5-ethyl-N,7,7-trimethyl-3-pent-4-enyloct-3-en-1-amine |
| SMILES | C=CCCCC(=CC(CC)CC(C)(C)C)CCNC |
| InChI | InChI=1S/C18H35N/c1-7-9-10-11-17(12-13-19-6)14-16(8-2)15-18(3,4)5/h7,14,16,19H,1,8-13,15H2,2-6H3 |
| InChIKey | QUJLWIYPMLEEKL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|