C13H20N2 — CID 91265314
4,7-diethyl-2H-benzimidazole;ethane (PubChem CID 91265314) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4,7-diethyl-2H-benzimidazole;ethane.
| Compound Name | 4,7-diethyl-2H-benzimidazole;ethane |
|---|---|
| PubChem CID | 91265314 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4,7-diethyl-2H-benzimidazole;ethane |
| SMILES | CC.CCc1ccc(CC)c2c1=NCN=2 |
| InChI | InChI=1S/C11H14N2.C2H6/c1-3-8-5-6-9(4-2)11-10(8)12-7-13-11;1-2/h5-6H,3-4,7H2,1-2H3;1-2H3 |
| InChIKey | IPRBXUOOXSDKCZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |