C25H42O3 — CID 91267791
2-(8,8-dimethyl-5-prop-1-en-2-yloctadeca-2,4,9-trien-3-yl)oxyacetic acid (PubChem CID 91267791) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-(8,8-dimethyl-5-prop-1-en-2-yloctadeca-2,4,9-trien-3-yl)oxyacetic acid.
| Compound Name | 2-(8,8-dimethyl-5-prop-1-en-2-yloctadeca-2,4,9-trien-3-yl)oxyacetic acid |
|---|---|
| PubChem CID | 91267791 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-(8,8-dimethyl-5-prop-1-en-2-yloctadeca-2,4,9-trien-3-yl)oxyacetic acid |
| SMILES | C=C(C)C(=CC(=CC)OCC(=O)O)CCC(C)(C)C=CCCCCCCCC |
| InChI | InChI=1S/C25H42O3/c1-7-9-10-11-12-13-14-15-17-25(5,6)18-16-22(21(3)4)19-23(8-2)28-20-24(26)27/h8,15,17,19H,3,7,9-14,16,18,20H2,1-2,4-6H3,(H,26,27) |
| InChIKey | CZOKZZHCBZBDHS-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|