C8H13N3O — CID 91270195
(pent-4-yn-2-ylideneamino) N,N'-dimethylcarbamimidate (PubChem CID 91270195) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (pent-4-yn-2-ylideneamino) N,N'-dimethylcarbamimidate.
| Compound Name | (pent-4-yn-2-ylideneamino) N,N'-dimethylcarbamimidate |
|---|---|
| PubChem CID | 91270195 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (pent-4-yn-2-ylideneamino) N,N'-dimethylcarbamimidate |
| SMILES | C#CCC(C)=NO/C(=N/C)NC |
| InChI | InChI=1S/C8H13N3O/c1-5-6-7(2)11-12-8(9-3)10-4/h1H,6H2,2-4H3,(H,9,10) |
| InChIKey | SOBNUBLVHZHYPR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|