C21H36 — CID 91276732
4,6,10-trimethyl-3-(2-methylcyclobutylidene)-9-propan-2-ylbicyclo[6.2.0]decane (PubChem CID 91276732) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 4,6,10-trimethyl-3-(2-methylcyclobutylidene)-9-propan-2-ylbicyclo[6.2.0]decane.
| Compound Name | 4,6,10-trimethyl-3-(2-methylcyclobutylidene)-9-propan-2-ylbicyclo[6.2.0]decane |
|---|---|
| PubChem CID | 91276732 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 4,6,10-trimethyl-3-(2-methylcyclobutylidene)-9-propan-2-ylbicyclo[6.2.0]decane |
| SMILES | CC1CC(C)C(=C2CCC2C)CC2C(C)C(C(C)C)C2C1 |
| InChI | InChI=1S/C21H36/c1-12(2)21-16(6)19-11-18(17-8-7-14(17)4)15(5)9-13(3)10-20(19)21/h12-16,19-21H,7-11H2,1-6H3 |
| InChIKey | NFLPPFZSTQMHBQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|