C22H16N8O2 — CID 91277835
4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-1(25),2,5,7,10,12,15,17,20,22(26)-decaene-23,24-dione (PubChem CID 91277835) has the molecular formula C22H16N8O2 and a molecular weight of 424.42 g/mol. Its IUPAC name is 4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-1(25),2,5,7,10,12,15,17,20,22(26)-decaene-23,24-dione.
| Compound Name | 4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-1(25),2,5,7,10,12,15,17,20,22(26)-decaene-23,24-dione |
|---|---|
| PubChem CID | 91277835 |
| Molecular Formula | C22H16N8O2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-1(25),2,5,7,10,12,15,17,20,22(26)-decaene-23,24-dione |
| SMILES | O=C1C(=O)c2ccc1c1c3[nH]c(c21)Nc1ccc([nH]1)Nc1ccc([nH]1)Nc1ccc([nH]1)N3 |
| InChI | InChI=1S/C22H16N8O2/c31-19-9-1-2-10(20(19)32)18-17(9)21-28-15-7-5-13(26-15)24-11-3-4-12(23-11)25-14-6-8-16(27-14)29-22(18)30-21/h1-8,23-30H |
| InChIKey | IWQRDKAPLOJXTI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|