C17H36O — CID 91278849
2,2,5-trimethyl-3-(3-methylhexoxy)heptane (PubChem CID 91278849) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is 2,2,5-trimethyl-3-(3-methylhexoxy)heptane.
| Compound Name | 2,2,5-trimethyl-3-(3-methylhexoxy)heptane |
|---|---|
| PubChem CID | 91278849 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | 2,2,5-trimethyl-3-(3-methylhexoxy)heptane |
| SMILES | CCCC(C)CCOC(CC(C)CC)C(C)(C)C |
| InChI | InChI=1S/C17H36O/c1-8-10-15(4)11-12-18-16(17(5,6)7)13-14(3)9-2/h14-16H,8-13H2,1-7H3 |
| InChIKey | NACBTZZHRTXASJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |