C25H39NO2 — CID 91279842
15-(2-bicyclo[2.2.1]heptanyl)-N-[(2R)-1-hydroxypropan-2-yl]pentadeca-5,8,11,14-tetraenamide (PubChem CID 91279842) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is 15-(2-bicyclo[2.2.1]heptanyl)-N-[(2R)-1-hydroxypropan-2-yl]pentadeca-5,8,11,14-tetraenamide.
| Compound Name | 15-(2-bicyclo[2.2.1]heptanyl)-N-[(2R)-1-hydroxypropan-2-yl]pentadeca-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 91279842 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | 15-(2-bicyclo[2.2.1]heptanyl)-N-[(2R)-1-hydroxypropan-2-yl]pentadeca-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCCC=CCC=CCC=CCC=CC1CC2CCC1C2 |
| InChI | InChI=1S/C25H39NO2/c1-21(20-27)26-25(28)15-13-11-9-7-5-3-2-4-6-8-10-12-14-23-18-22-16-17-24(23)19-22/h2-3,6-9,12,14,21-24,27H,4-5,10-11,13,15-20H2,1H3,(H,26,28)/t21-,22?,23?,24?/m1/s1 |
| InChIKey | YILYUXGIWYFLFA-CIBMOVPQSA-N |
| XLogP | 5.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|