C21H23F3N6O3S — CID 91284373
2-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol (PubChem CID 91284373) has the molecular formula C21H23F3N6O3S and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol.
| Compound Name | 2-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol |
|---|---|
| PubChem CID | 91284373 |
| Molecular Formula | C21H23F3N6O3S |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol |
| SMILES | CCc1nccc2sc(-c3c(C)nc(NCC(F)(F)F)nc3NC3(O)CCC4C(O)C43O)nc12 |
| InChI | InChI=1S/C21H23F3N6O3S/c1-3-11-14-12(5-7-25-11)34-17(28-14)13-9(2)27-18(26-8-20(22,23)24)29-16(13)30-19(32)6-4-10-15(31)21(10,19)33/h5,7,10,15,31-33H,3-4,6,8H2,1-2H3,(H2,26,27,29,30) |
| InChIKey | MLQFVVBYLCPVCP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|