C22H35N5S2 — CID 91284408
[1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl N-ethenyl-4-piperidin-1-ylpiperidine-1-carboximidothioate (PubChem CID 91284408) has the molecular formula C22H35N5S2 and a molecular weight of 433.69 g/mol. Its IUPAC name is [1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl N-ethenyl-4-piperidin-1-ylpiperidine-1-carboximidothioate.
| Compound Name | [1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl N-ethenyl-4-piperidin-1-ylpiperidine-1-carboximidothioate |
|---|---|
| PubChem CID | 91284408 |
| Molecular Formula | C22H35N5S2 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl N-ethenyl-4-piperidin-1-ylpiperidine-1-carboximidothioate |
| SMILES | C=C/N=C(\SCC1CCCN(c2nccs2)C1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C22H35N5S2/c1-2-23-21(26-14-8-20(9-15-26)25-11-4-3-5-12-25)29-18-19-7-6-13-27(17-19)22-24-10-16-28-22/h2,10,16,19-20H,1,3-9,11-15,17-18H2/b23-21- |
| InChIKey | FCFKSKFGDQZHRX-LNVKXUELSA-N |
| XLogP | 4.54 |
| TPSA | 34.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|