C57H102O6 — CID 91284581
2,3-dihydroxypropyl 2-hexadeca-7,10-dienyl-2-octadec-9-enoyl-3-oxoicos-11-enoate (PubChem CID 91284581) has the molecular formula C57H102O6 and a molecular weight of 883.44 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-hexadeca-7,10-dienyl-2-octadec-9-enoyl-3-oxoicos-11-enoate.
| Compound Name | 2,3-dihydroxypropyl 2-hexadeca-7,10-dienyl-2-octadec-9-enoyl-3-oxoicos-11-enoate |
|---|---|
| PubChem CID | 91284581 |
| Molecular Formula | C57H102O6 |
| Molecular Weight | 883.44 g/mol |
| Exact Mass | 882.77 |
| IUPAC Name | 2,3-dihydroxypropyl 2-hexadeca-7,10-dienyl-2-octadec-9-enoyl-3-oxoicos-11-enoate |
| SMILES | CCCCCC=CCC=CCCCCCCC(C(=O)CCCCCCCC=CCCCCCCCC)(C(=O)CCCCCCCC=CCCCCCCCC)C(=O)OCC(O)CO |
| InChI | InChI=1S/C57H102O6/c1-4-7-10-13-16-19-22-25-28-30-33-36-39-42-45-48-54(60)57(56(62)63-52-53(59)51-58,50-47-44-41-38-35-32-27-24-21-18-15-12-9-6-3)55(61)49-46-43-40-37-34-31-29-26-23-20-17-14-11-8-5-2/h18,21,25-29,32,53,58-59H,4-17,19-20,22-24,30-31,33-52H2,1-3H3 |
| InChIKey | TXLCNWCLNQHGBQ-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.44 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|