C27H27N3O8 — CID 91288023
(2,5-dihydroxypyrrol-1-yl) 3-[2-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]ethoxy]propanoate (PubChem CID 91288023) has the molecular formula C27H27N3O8 and a molecular weight of 521.53 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[2-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]ethoxy]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]ethoxy]propanoate |
|---|---|
| PubChem CID | 91288023 |
| Molecular Formula | C27H27N3O8 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]ethoxy]propanoate |
| SMILES | COc1ccc(-c2cc(C(=O)NCCOCCC(=O)On3c(O)ccc3O)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C27H27N3O8/c1-35-22-8-7-17(15-23(22)36-2)21-16-19(18-5-3-4-6-20(18)29-21)27(34)28-12-14-37-13-11-26(33)38-30-24(31)9-10-25(30)32/h3-10,15-16,31-32H,11-14H2,1-2H3,(H,28,34) |
| InChIKey | VKNLQWVQSIICIB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|