C24H29ClN6O — CID 91288602
2-(3-chloro-N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]anilino)acetamide (PubChem CID 91288602) has the molecular formula C24H29ClN6O and a molecular weight of 452.99 g/mol. Its IUPAC name is 2-(3-chloro-N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]anilino)acetamide.
| Compound Name | 2-(3-chloro-N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]anilino)acetamide |
|---|---|
| PubChem CID | 91288602 |
| Molecular Formula | C24H29ClN6O |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-(3-chloro-N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]anilino)acetamide |
| SMILES | CN(C)c1nc(NC2CCC(N(CC(N)=O)c3cccc(Cl)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H29ClN6O/c1-30(2)23-20-8-3-4-9-21(20)28-24(29-23)27-17-10-12-18(13-11-17)31(15-22(26)32)19-7-5-6-16(25)14-19/h3-9,14,17-18H,10-13,15H2,1-2H3,(H2,26,32)(H,27,28,29) |
| InChIKey | DNAJZEVIYDSAQX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |