C17H15BrO — CID 91289776
6-[(4-bromophenyl)methyl]-7,8-dihydronaphthalen-2-ol (PubChem CID 91289776) has the molecular formula C17H15BrO and a molecular weight of 315.21 g/mol. Its IUPAC name is 6-[(4-bromophenyl)methyl]-7,8-dihydronaphthalen-2-ol.
| Compound Name | 6-[(4-bromophenyl)methyl]-7,8-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 91289776 |
| Molecular Formula | C17H15BrO |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 6-[(4-bromophenyl)methyl]-7,8-dihydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)CCC(Cc1ccc(Br)cc1)=C2 |
| InChI | InChI=1S/C17H15BrO/c18-16-6-2-12(3-7-16)9-13-1-4-15-11-17(19)8-5-14(15)10-13/h2-3,5-8,10-11,19H,1,4,9H2 |
| InChIKey | SRQCVCNCPOMEFA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |