C11H12BrN — CID 83842648
(7-bromo-3,4-dihydronaphthalen-2-yl)methanamine (PubChem CID 83842648) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is (7-bromo-3,4-dihydronaphthalen-2-yl)methanamine.
| Compound Name | (7-bromo-3,4-dihydronaphthalen-2-yl)methanamine |
|---|---|
| PubChem CID | 83842648 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | (7-bromo-3,4-dihydronaphthalen-2-yl)methanamine |
| SMILES | NCC1=Cc2cc(Br)ccc2CC1 |
| InChI | InChI=1S/C11H12BrN/c12-11-4-3-9-2-1-8(7-13)5-10(9)6-11/h3-6H,1-2,7,13H2 |
| InChIKey | GMJPEVURXIPTQL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |