C18H26O9 — CID 91295900
[2,3-diacetyloxy-3-(6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate (PubChem CID 91295900) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is [2,3-diacetyloxy-3-(6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate.
| Compound Name | [2,3-diacetyloxy-3-(6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate |
|---|---|
| PubChem CID | 91295900 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [2,3-diacetyloxy-3-(6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C1OC(C)(C)CC2OC(=O)CC21 |
| InChI | InChI=1S/C18H26O9/c1-9(19)23-8-14(24-10(2)20)17(25-11(3)21)16-12-6-15(22)26-13(12)7-18(4,5)27-16/h12-14,16-17H,6-8H2,1-5H3 |
| InChIKey | PHTSMJDZLVIVAM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|