C14H18ClN6O7+ — CID 91297916
2-chloroethyl-[4-[(2,4-dinitrobenzoyl)amino]butylcarbamoylamino]-oxoazanium (PubChem CID 91297916) has the molecular formula C14H18ClN6O7+ and a molecular weight of 417.79 g/mol. Its IUPAC name is 2-chloroethyl-[4-[(2,4-dinitrobenzoyl)amino]butylcarbamoylamino]-oxoazanium.
| Compound Name | 2-chloroethyl-[4-[(2,4-dinitrobenzoyl)amino]butylcarbamoylamino]-oxoazanium |
|---|---|
| PubChem CID | 91297916 |
| Molecular Formula | C14H18ClN6O7+ |
| Molecular Weight | 417.79 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-chloroethyl-[4-[(2,4-dinitrobenzoyl)amino]butylcarbamoylamino]-oxoazanium |
| SMILES | O=C(NCCCCNC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])N[N+](=O)CCCl |
| InChI | InChI=1S/C14H17ClN6O7/c15-5-8-19(24)18-14(23)17-7-2-1-6-16-13(22)11-4-3-10(20(25)26)9-12(11)21(27)28/h3-4,9H,1-2,5-8H2,(H2-,16,17,18,22,23,24)/p+1 |
| InChIKey | GKHJLNLHTNWUMT-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.79 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|