C6H13N3 — CID 91302987
3,5-dimethyl-1H-1,2,4-triazole;ethane (PubChem CID 91302987) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is 3,5-dimethyl-1H-1,2,4-triazole;ethane.
| Compound Name | 3,5-dimethyl-1H-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 91302987 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 3,5-dimethyl-1H-1,2,4-triazole;ethane |
| SMILES | CC.Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C4H7N3.C2H6/c1-3-5-4(2)7-6-3;1-2/h1-2H3,(H,5,6,7);1-2H3 |
| InChIKey | PXHODFDOEPBCEX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |